2-(Methylsulfonyl)-10H-phenothiazine, 98%
cas: 23503-68-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-(Methylsulfonyl)-10H-phenothiazine, 98% (CAS 23503-68-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 250mg, 5g. Oferty producentów: Fluorochem, Ambeed, Chemat, BLDpharm.
| producent | Fluorochem |
|---|---|
| nr katalogowy | F212696-1G |
| cas | 23503-68-6 |
| opakowanie | 1g |
| dostępność | In Stock China |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Fluorochem | 1g | 393,63 Pln | |
| Ambeed | 250mg | 203,50 Pln | |
| Ambeed | 1g | 387,06 Pln | |
| Ambeed | 5g | 1338,25 Pln | |
| Chemat | 250mg | 179,60 Pln | |
| Chemat | 1g | 275,60 Pln | |
| Chemat | 5g | 1134,80 Pln | |
| BLDpharm | 250mg | 203,29 Pln | |
| BLDpharm | 1g | 414,32 Pln | |
| BLDpharm | 5g | 1441,74 Pln |
właściwości
| czystość | 98% |
|---|---|
| podwójne zastosowanie | No |
| waluta | EUR |
| czas dostawy | 2-3 tygodnie |
| kategoria | Odczynniki chemiczne |
2-methylsulfonyl-10H-phenothiazine (CAS 23503-68-6) to związek chemiczny o wzorze sumarycznym C13H11NO2S2 i masie molowej 277.4 g/mol. Nazwa systematyczna IUPAC: 2-methylsulfonyl-10H-phenothiazine. InChIKey: XMSALNTWEPZQLO-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H11NO2S2 |
|---|---|
| Masa molowa | 277.4 g/mol |
| Nazwa IUPAC | 2-methylsulfonyl-10H-phenothiazine |
| InChIKey | XMSALNTWEPZQLO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2-(methylsulfonyl)-10h-phenothiazine, 2-(Methylsulphonyl)-10H-phenothiazine, 2-methylsulfonyl-10H-phenothiazine, 2-(Methylsulfonyl) Phenothiazine, 10H-Phenothiazine, 2-(methylsulfonyl)-, Metopimazine Impurity 2, 2-methanesulfonyl-10H-phenothiazine, 2-(Methylsulfonyl), Sulforidazine M (ring), 2-methylsulfonyl phenothiazine