2-(Thiophen-2-yl)ethyl 4-methylbenzenesulfonate, 97%, 97%
cas: 40412-06-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-(Thiophen-2-yl)ethyl 4-methylbenzenesulfonate, 97%, 97% (CAS 40412-06-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1kg, 5g, 10g, 25g, 100g, 500g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114F61-1kg |
| cas | 40412-06-4 |
| opakowanie | 1kg |
| dostępność | 2000g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1kg | 770,00 Pln | |
| Chemat | 5g | 78,80 Pln | |
| Chemat | 10g | 78,80 Pln | |
| Chemat | 25g | 83,60 Pln | |
| Chemat | 100g | 136,40 Pln | |
| Chemat | 500g | 427,20 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
2-thiophen-2-ylethyl 4-methylbenzenesulfonate (CAS 40412-06-4) to związek chemiczny o wzorze sumarycznym C13H14O3S2 i masie molowej 282.4 g/mol. Nazwa systematyczna IUPAC: 2-thiophen-2-ylethyl 4-methylbenzenesulfonate. InChIKey: HLPRKWVEMYDPAU-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H14O3S2 |
|---|---|
| Masa molowa | 282.4 g/mol |
| Nazwa IUPAC | 2-thiophen-2-ylethyl 4-methylbenzenesulfonate |
| InChIKey | HLPRKWVEMYDPAU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCC2=CC=CS2 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2-(2-Thienyl)ethyl toluene-p-sulphonate, 2-Thiopheneethanol Tosylate, 2-(2-Thienyl)ethyl Toluene-p-sulfonate, 2-Thiopheneethanol, 2-(4-methylbenzenesulfonate), 2-Thiopheneethanol, 4-methylbenzenesulfonate, 2-(Thiophen-2-yl)ethyl 4-methylbenzenesulfonate, 2-thiophen-2-ylethyl 4-methylbenzenesulfonate, Clopidogrel Impurity 13, 2-(2-Thienyl)ethyl p-Toluenesulfonate, 2-(thiophen-2-yl)ethyl 4-methylbenzene-1-sulfonate