cas: 1445019-24-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-[4-methoxy-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98% (CAS 1445019-24-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch132158-100mg |
| cas | 1445019-24-8 |
| opakowanie | 100mg |
| dostępność | 7g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 261,20 Pln | |
| Chemat | 250mg | 400,40 Pln | |
| Chemat | 1g | 971,60 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
2-[4-methoxy-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1445019-24-8) to związek chemiczny o wzorze sumarycznym C14H18BF3O3 i masie molowej 302.10 g/mol. Nazwa systematyczna IUPAC: 2-[4-methoxy-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MDCAOOMRVSIDTJ-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H18BF3O3 |
|---|---|
| Masa molowa | 302.10 g/mol |
| Nazwa IUPAC | 2-[4-methoxy-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MDCAOOMRVSIDTJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)