2-Fluoro-[1,1'-biphenyl]-4-carboxylic acid, 95%
cas: 137045-30-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-Fluoro-[1,1'-biphenyl]-4-carboxylic acid, 95% (CAS 137045-30-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 100mg. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A797244-250mg |
| cas | 137045-30-8 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 275,81 Pln | |
| Ambeed | 1g | 331,44 Pln | |
| Ambeed | 5g | 1026,75 Pln | |
| Chemat | 100mg | 251,60 Pln | |
| Chemat | 250mg | 366,80 Pln | |
| Chemat | 1g | 1154,00 Pln | |
| Chemat | 5g | 4336,40 Pln | |
| BLDpharm | 100mg | 242,16 Pln | |
| BLDpharm | 250mg | 292,14 Pln | |
| BLDpharm | 1g | 347,68 Pln | |
| BLDpharm | 5g | 1102,97 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 1-2 tygodnie |
3-fluoro-4-phenylbenzoic acid (CAS 137045-30-8) to związek chemiczny o wzorze sumarycznym C13H9FO2 i masie molowej 216.21 g/mol. Nazwa systematyczna IUPAC: 3-fluoro-4-phenylbenzoic acid. InChIKey: PFKITESTTSWHMP-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H9FO2 |
|---|---|
| Masa molowa | 216.21 g/mol |
| Nazwa IUPAC | 3-fluoro-4-phenylbenzoic acid |
| InChIKey | PFKITESTTSWHMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)C(=O)O)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2-Fluorobiphenyl-4-carboxylic acid, [1,1'-Biphenyl]-4-carboxylic acid, 2-fluoro-, FLURBIPROFEN IMPURITY E [EP IMPURITY], FLURBIPROFEN IMPURITY E (EP IMPURITY), 2-Fluoro-[1,1'-biphenyl]-4-carboxylic acid, 3-fluoro-4-phenylbenzoic acid, FLURBIPROFEN EP IMPURITY E, Flurbiprofen Impurity E, 2-Fluorobiphenyl-4-carboxylic acid 97%, 3-fluoro-4-phenyl-benzoic acid