2-Fluoro-6-(trifluoromethyl)benzylamine HCl, 95%
cas: 643088-07-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-Fluoro-6-(trifluoromethyl)benzylamine HCl, 95% (CAS 643088-07-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11EC8G-100mg |
| cas | 643088-07-7 |
| opakowanie | 100mg |
| dostępność | 100g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 78,80 Pln | |
| Chemat | 250mg | 83,60 Pln | |
| Chemat | 1g | 122,00 Pln | |
| Chemat | 5g | 410,00 Pln | |
| Chemat | 10g | 755,60 Pln | |
| Chemat | 25g | 1792,40 Pln | |
| Chemat | 100g | 6467,60 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
[2-fluoro-6-(trifluoromethyl)phenyl]methanamine;hydrochloride (CAS 643088-07-7) to związek chemiczny o wzorze sumarycznym C8H8ClF4N i masie molowej 229.60 g/mol. Nazwa systematyczna IUPAC: [2-fluoro-6-(trifluoromethyl)phenyl]methanamine;hydrochloride. InChIKey: YSYBSZNUTHPMGA-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H8ClF4N |
|---|---|
| Masa molowa | 229.60 g/mol |
| Nazwa IUPAC | [2-fluoro-6-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| InChIKey | YSYBSZNUTHPMGA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CN)C(F)(F)F.Cl |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(2-Fluoro-6-(trifluoromethyl)phenyl)methanamine hydrochloride, [2-fluoro-6-(trifluoromethyl)phenyl]methanamine;hydrochloride, 2-Fluoro-6-(trifluoromethyl)benzylamine HCl, 2-Fluoro-6-(trifluoromethyl)benzylamine hydrochloride, 2-Fluoro-6-trifluoromethylbenzylamin hydrochloride, [2-fluoro-6-(trifluoromethyl)phenyl]methanamine hydrochloride, elagolix intermediate 2, YSYBSZNUTHPMGA-UHFFFAOYSA-N, 1-[2-Fluoro-6-(trifluoromethyl)phenyl] 2-methanamine, (2-Fluoro-6-(trifluoromethyl)phenyl)methanaminehydrochloride