2-Fluoro-DL-mandelic Acid, 97%, 97%
cas: 389-31-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-Fluoro-DL-mandelic Acid, 97%, 97% (CAS 389-31-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114HBY-100mg |
| cas | 389-31-1 |
| opakowanie | 100mg |
| dostępność | 50g |
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 93,20 Pln | |
| Chemat | 250mg | 107,60 Pln | |
| Chemat | 1g | 150,80 Pln | |
| Chemat | 5g | 434,00 Pln | |
| Chemat | 25g | 1312,40 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
2-(2-fluorophenyl)-2-hydroxyacetic acid (CAS 389-31-1) to związek chemiczny o wzorze sumarycznym C8H7FO3 i masie molowej 170.14 g/mol. Nazwa systematyczna IUPAC: 2-(2-fluorophenyl)-2-hydroxyacetic acid. InChIKey: WWSRHIZZWWDONI-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H7FO3 |
|---|---|
| Masa molowa | 170.14 g/mol |
| Nazwa IUPAC | 2-(2-fluorophenyl)-2-hydroxyacetic acid |
| InChIKey | WWSRHIZZWWDONI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)O)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2-Fluoro-DL-mandelic Acid, 2-Fluoromandelic acid, 2-(2-fluorophenyl)-2-hydroxyacetic acid, o-fluoromandelic acid, 2-Fluoro-DL-mandelicAcid, (2-fluorophenyl)(hydroxy)acetic acid, 2-(2-fluorophenyl)-2-hydroxy-acetic Acid, 2-Fluoromandelic acid, AldrichCPR, acetic acid, 2-(2-fluorophenyl)-2-hydroxy-