cas: 1354819-26-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-Hydroxy-5-(trifluoromethoxy)phenylboronic acid, 96%, 96% (CAS 1354819-26-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11HU75-250mg |
| cas | 1354819-26-3 |
| opakowanie | 250mg |
| dostępność | 75g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 227,60 Pln | |
| Chemat | 1g | 390,80 Pln | |
| Chemat | 5g | 880,40 Pln | |
| Chemat | 10g | 1456,40 Pln | |
| Chemat | 25g | 2680,40 Pln |
| czystość | 96% |
|---|---|
| czas dostawy | 3 tygodnie |
[2-hydroxy-5-(trifluoromethoxy)phenyl]boronic acid (CAS 1354819-26-3) to związek chemiczny o wzorze sumarycznym C7H6BF3O4 i masie molowej 221.93 g/mol. Nazwa systematyczna IUPAC: [2-hydroxy-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: KZPLYVRPYPBPSQ-UHFFFAOYSA-N.
| Wzór sumaryczny | C7H6BF3O4 |
|---|---|
| Masa molowa | 221.93 g/mol |
| Nazwa IUPAC | [2-hydroxy-5-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | KZPLYVRPYPBPSQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC(F)(F)F)O)(O)O |
Dane obliczone przez PubChem (NCBI)