2-Methyl-2-(4-(trifluoromethyl)phenyl)propanoic acid, 98%
cas: 32445-89-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-Methyl-2-(4-(trifluoromethyl)phenyl)propanoic acid, 98% (CAS 32445-89-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A168402-100mg |
| cas | 32445-89-9 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 364,81 Pln | |
| Ambeed | 250mg | 492,75 Pln | |
| Ambeed | 1g | 1021,19 Pln | |
| Chemat | 100mg | 338,00 Pln | |
| Chemat | 250mg | 501,20 Pln | |
| Chemat | 1g | 1206,80 Pln | |
| BLDpharm | 100mg | 353,23 Pln | |
| BLDpharm | 250mg | 525,40 Pln | |
| BLDpharm | 1g | 1097,42 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 1-2 tygodnie |
2-methyl-2-[4-(trifluoromethyl)phenyl]propanoic acid (CAS 32445-89-9) to związek chemiczny o wzorze sumarycznym C11H11F3O2 i masie molowej 232.20 g/mol. Nazwa systematyczna IUPAC: 2-methyl-2-[4-(trifluoromethyl)phenyl]propanoic acid. InChIKey: HJQVJNQZQTWNPZ-UHFFFAOYSA-N.
| Wzór sumaryczny | C11H11F3O2 |
|---|---|
| Masa molowa | 232.20 g/mol |
| Nazwa IUPAC | 2-methyl-2-[4-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | HJQVJNQZQTWNPZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)C(F)(F)F)C(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2-Methyl-2-[4-(trifluoromethyl)phenyl]propanoic acid, 2-Methyl-2-(4-(trifluoromethyl)phenyl)propanoic acid, alpha,alpha-Dimethyl-4-(trifluoromethyl)benzeneacetic Acid, 2-Methyl-2-[4-(trifluoromethyl)phenyl]propanoic acid, 2-methyl-2-(4-trifluoromethyl-phenyl)-propionic acid, 2-methyl-2-(4-trifluoromethylph, ?,?-Dimethyl-4-(trifluoromethyl)benzeneacetic Acid, 2-Methyl-2-(4-(trifluoromethyl)phenyl)propanoicacid