2-Methyl-4-(trifluoromethoxy)phenylboronic acid, 98%
cas: 850033-39-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-Methyl-4-(trifluoromethoxy)phenylboronic acid, 98% (CAS 850033-39-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 100mg. Oferty producentów: Ambeed, Chemat, BLDpharm, Fluorochem.
| producent | Ambeed |
|---|---|
| nr katalogowy | A525617-250mg |
| cas | 850033-39-5 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 670,75 Pln | |
| Ambeed | 1g | 1338,25 Pln | |
| Ambeed | 5g | 6416,81 Pln | |
| Chemat | 100mg | 587,60 Pln | |
| Chemat | 250mg | 971,60 Pln | |
| Chemat | 1g | 2512,40 Pln | |
| Chemat | 5g | 8632,40 Pln | |
| BLDpharm | 100mg | 447,64 Pln | |
| BLDpharm | 250mg | 719,77 Pln | |
| BLDpharm | 1g | 1441,74 Pln | |
| BLDpharm | 5g | 6912,04 Pln | |
| Fluorochem | 250mg | 1794,18 Pln | |
| Fluorochem | 1g | 4652,55 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 2-3 tygodnie |
[2-methyl-4-(trifluoromethoxy)phenyl]boronic acid (CAS 850033-39-5) to związek chemiczny o wzorze sumarycznym C8H8BF3O3 i masie molowej 219.96 g/mol. Nazwa systematyczna IUPAC: [2-methyl-4-(trifluoromethoxy)phenyl]boronic acid. InChIKey: VZNGQLGNHIYWOD-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H8BF3O3 |
|---|---|
| Masa molowa | 219.96 g/mol |
| Nazwa IUPAC | [2-methyl-4-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | VZNGQLGNHIYWOD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC(F)(F)F)C)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2-Methyl-4-(trifluoromethoxy)benzeneboronic acid, 2-methyl-4-(trifluoromethoxy)phenylboronic acid, [2-methyl-4-(trifluoromethoxy)phenyl]boronic acid, 2-Methyl-4-trifluoromethoxyphenylboronic acid, (2-methyl-4-(trifluoromethoxy)phenyl)boronic acid, 2-Methyl-4-(trifluoromethoxy)phenylboronicacid, Boronic acid,B-[2-methyl-4-(trifluoromethoxy)phenyl]-, Boronic acid, [2-methyl-4-(trifluoromethoxy)phenyl]-