2-Methyl-5-[(4-methylphenyl)amino]benzothiazole-4,7-dione, 98%, 98%
cas: 265312-55-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-Methyl-5-[(4-methylphenyl)amino]benzothiazole-4,7-dione, 98%, 98% (CAS 265312-55-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch118LC6-1mg |
| cas | 265312-55-8 |
| opakowanie | 1mg |
| dostępność | 0.35g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1mg | 458,00 Pln | |
| Chemat | 5mg | 1163,60 Pln | |
| Chemat | 10mg | 1557,20 Pln | |
| Chemat | 25mg | 2690,00 Pln | |
| Chemat | 50mg | 3765,20 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
2-methyl-5-(4-methylanilino)-1,3-benzothiazole-4,7-dione (CAS 265312-55-8) to związek chemiczny o wzorze sumarycznym C15H12N2O2S i masie molowej 284.3 g/mol. Nazwa systematyczna IUPAC: 2-methyl-5-(4-methylanilino)-1,3-benzothiazole-4,7-dione. InChIKey: HFPLHASLIOXVGS-UHFFFAOYSA-N.
| Wzór sumaryczny | C15H12N2O2S |
|---|---|
| Masa molowa | 284.3 g/mol |
| Nazwa IUPAC | 2-methyl-5-(4-methylanilino)-1,3-benzothiazole-4,7-dione |
| InChIKey | HFPLHASLIOXVGS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=CC(=O)C3=C(C2=O)N=C(S3)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Ryuvidine, Cdk4 Inhibitor III, 2-methyl-5-[(4-methylphenyl)amino]-4,7-dihydro-1,3-benzothiazole-4,7-dione, 2-methyl-5-((4-methylphenyl)amino)-4,7-dihydro-1,3-benzothiazole-4,7-dione, 2-Methyl-5-[(4-methylphenyl)amino]benzothiazole-4,7-dione, 2-methyl-5-(p-tolylamino)benzo[d]thiazole-4,7-dione, 2-methyl-5-(4-methylanilino)-1,3-benzothiazole-4,7-dione, Ryuvidine?, 5-(N-(4-Methylphenyl)amino)-2-methyl-4,7-dioxobenzothiazole, 2-Methyl-5-p-tolylamino-benzothiazole-4,7-dione