cas: 1195931-65-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-Methyl-5-nitrophenyl trifluoromethanesulphonate, 98%, 98% (CAS 1195931-65-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50mg, 100mg, 250mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch13M66L-50mg |
| cas | 1195931-65-7 |
| opakowanie | 50mg |
| dostępność | 3g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 50mg | 472,40 Pln | |
| Chemat | 100mg | 760,40 Pln | |
| Chemat | 250mg | 1379,60 Pln | |
| Chemat | 1g | 3616,40 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
(2-methyl-5-nitrophenyl) trifluoromethanesulfonate (CAS 1195931-65-7) to związek chemiczny o wzorze sumarycznym C8H6F3NO5S i masie molowej 285.20 g/mol. Nazwa systematyczna IUPAC: (2-methyl-5-nitrophenyl) trifluoromethanesulfonate. InChIKey: WTSMAYFALLTGPR-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H6F3NO5S |
|---|---|
| Masa molowa | 285.20 g/mol |
| Nazwa IUPAC | (2-methyl-5-nitrophenyl) trifluoromethanesulfonate |
| InChIKey | WTSMAYFALLTGPR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])OS(=O)(=O)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)