2-Methyladamantan-2-yl methacrylate, 98%
cas: 177080-67-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-Methyladamantan-2-yl methacrylate, 98% (CAS 177080-67-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 10g, 25g. Oferty producentów: Chemat, Fluorochem.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11364Q-1g |
| cas | 177080-67-0 |
| opakowanie | 1g |
| dostępność | 50g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1g | 93,20 Pln | |
| Chemat | 5g | 165,20 Pln | |
| Chemat | 10g | 251,60 Pln | |
| Chemat | 25g | 438,80 Pln | |
| Fluorochem | 1g | 143,72 Pln | |
| Fluorochem | 5g | 279,09 Pln | |
| Fluorochem | 25g | 794,53 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
(2-methyl-2-adamantyl) 2-methylprop-2-enoate (CAS 177080-67-0) to związek chemiczny o wzorze sumarycznym C15H22O2 i masie molowej 234.33 g/mol. Nazwa systematyczna IUPAC: (2-methyl-2-adamantyl) 2-methylprop-2-enoate. InChIKey: FDYDISGSYGFRJM-UHFFFAOYSA-N.
| Wzór sumaryczny | C15H22O2 |
|---|---|
| Masa molowa | 234.33 g/mol |
| Nazwa IUPAC | (2-methyl-2-adamantyl) 2-methylprop-2-enoate |
| InChIKey | FDYDISGSYGFRJM-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC1(C2CC3CC(C2)CC1C3)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2-Methacryloyloxy-2-methyladamantane, 2-Methyladamantan-2-yl methacrylate, 2-Methyl-2-adamantylmethacrylate, (2-methyl-2-adamantyl) 2-methylprop-2-enoate, 2-Methyl-acrylic acid 2-methyl-adamantan-2-yl ester, 2-methacryloyloxy-2-methyladamantane (stabilized with mehq), 2-Propenoic acid, 2-methyl-, 2-methyltricyclo[3.3.1.13,7]dec-2-yl ester, 2-Methacryloyloxy-2-methyladamantane(stabilizedwithMEHQ), Methacrylic Acid 2-Methyl-2-adamantyl Ester, 2-Methyladamantan-2-ylmethacrylate