2-Phenylethene-1-sulfonyl fluoride, 95%, 95%
cas: 405-18-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-Phenylethene-1-sulfonyl fluoride, 95%, 95% (CAS 405-18-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11I8XP-250mg |
| cas | 405-18-5 |
| opakowanie | 250mg |
| dostępność | 5g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 410,00 Pln | |
| Chemat | 1g | 1034,00 Pln | |
| Chemat | 5g | 3304,40 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
(E)-2-phenylethenesulfonyl fluoride (CAS 405-18-5) to związek chemiczny o wzorze sumarycznym C8H7FO2S i masie molowej 186.21 g/mol. Nazwa systematyczna IUPAC: (E)-2-phenylethenesulfonyl fluoride. InChIKey: VDCNEIUADPFQPG-VOTSOKGWSA-N.
| Wzór sumaryczny | C8H7FO2S |
|---|---|
| Masa molowa | 186.21 g/mol |
| Nazwa IUPAC | (E)-2-phenylethenesulfonyl fluoride |
| InChIKey | VDCNEIUADPFQPG-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/S(=O)(=O)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Ethenesulfonyl fluoride, 2-phenyl-, (1E)-2-phenylethene-1-sulfonyl fluoride, (E)-2-phenylethene-1-sulfonyl fluoride, 2-phenylethene-1-sulfonyl fluoride, (E)-2-phenylethenesulfonyl fluoride, 2-phenylethenesulfonyl fluoride, 2-Phenylethenesulfonyl fluoride, 95%, (E)-2-phenylethene-1-sulfonylfluoride