2-Propenoic acid, 3-(3-nitrophenyl)-, 97%, 97%
cas: 555-68-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-Propenoic acid, 3-(3-nitrophenyl)-, 97%, 97% (CAS 555-68-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5g, 25g, 100g, 500g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114JTC-5g |
| cas | 555-68-0 |
| opakowanie | 5g |
| dostępność | 979g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 5g | 78,80 Pln | |
| Chemat | 25g | 117,20 Pln | |
| Chemat | 100g | 275,60 Pln | |
| Chemat | 500g | 1190,40 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
(E)-3-(3-nitrophenyl)prop-2-enoic acid (CAS 555-68-0) to związek chemiczny o wzorze sumarycznym C9H7NO4 i masie molowej 193.16 g/mol. Nazwa systematyczna IUPAC: (E)-3-(3-nitrophenyl)prop-2-enoic acid. InChIKey: WWXMVRYHLZMQIG-SNAWJCMRSA-N.
| Wzór sumaryczny | C9H7NO4 |
|---|---|
| Masa molowa | 193.16 g/mol |
| Nazwa IUPAC | (E)-3-(3-nitrophenyl)prop-2-enoic acid |
| InChIKey | WWXMVRYHLZMQIG-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])/C=C/C(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
3-Nitrocinnamic acid, m-Nitrocinnamic acid, trans-3-Nitrocinnamic acid, (2E)-3-(3-nitrophenyl)prop-2-enoic acid, 3-Nitrobenzenepropenoic acid, Cinnamic acid, m-nitro, 3-(3-nitrophenyl)acrylic acid, (2E)-3-(3-nitrophenyl)acrylic acid, 2-Propenoic acid, 3-(3-nitrophenyl)-, (2E)-, Cinnamic acid, m-nitro-