2-Thiophen-2-yl-quinoline-4-carboxylic acid, 95%, 95%
cas: 31792-47-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-Thiophen-2-yl-quinoline-4-carboxylic acid, 95%, 95% (CAS 31792-47-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11BYNV-250mg |
| cas | 31792-47-9 |
| opakowanie | 250mg |
| dostępność | 10g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 453,20 Pln | |
| Chemat | 1g | 1115,60 Pln | |
| Chemat | 5g | 3746,00 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
2-thiophen-2-ylquinoline-4-carboxylic acid (CAS 31792-47-9) to związek chemiczny o wzorze sumarycznym C14H9NO2S i masie molowej 255.29 g/mol. Nazwa systematyczna IUPAC: 2-thiophen-2-ylquinoline-4-carboxylic acid. InChIKey: YDZHUFHFHQWQQB-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H9NO2S |
|---|---|
| Masa molowa | 255.29 g/mol |
| Nazwa IUPAC | 2-thiophen-2-ylquinoline-4-carboxylic acid |
| InChIKey | YDZHUFHFHQWQQB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=CC=CS3)C(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2-(thiophen-2-yl)quinoline-4-carboxylic acid, 2-Thiophen-2-yl-quinoline-4-carboxylic acid, 2-(2-thienyl)quinoline-4-carboxylic acid, 2-thiophen-2-ylquinoline-4-carboxylic acid, 2-(2-Thienyl)-4-quinolinecarboxylic acid, 2-thien-2-ylquinoline-4-carboxylic acid, 2-[2-Thienyl]cinchoninic acid, Enamine_001347, CBMicro_024213, Cambridge id 5403248