2-tert-Butyl-3,3-dimethylbutanoic acid, 95%
cas: 41785-81-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-tert-Butyl-3,3-dimethylbutanoic acid, 95% (CAS 41785-81-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 100mg, 250mg. Oferty producentów: Combi-blocks, Fluorochem, Chemat.
| producent | Combi-blocks |
|---|---|
| nr katalogowy | JB-7564-1g |
| cas | 41785-81-3 |
| opakowanie | 1g |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Combi-blocks | 1g | cena na żądanie | |
| Combi-blocks | 100mg | cena na żądanie | |
| Combi-blocks | 250mg | cena na żądanie | |
| Fluorochem | 100mg | 1013,20 Pln | |
| Fluorochem | 250mg | 1710,87 Pln | |
| Fluorochem | 1g | 3319,68 Pln | |
| Chemat | 100mg | 611,60 Pln | |
| Chemat | 250mg | 1029,20 Pln | |
| Chemat | 1g | 1994,00 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 1-2 tygodnie, tylko jeżeli na stocku, by sprawdzić kliknij dostępność |
2-tert-butyl-3,3-dimethylbutanoic acid (CAS 41785-81-3) to związek chemiczny o wzorze sumarycznym C10H20O2 i masie molowej 172.26 g/mol. Nazwa systematyczna IUPAC: 2-tert-butyl-3,3-dimethylbutanoic acid. InChIKey: CSUSKPNFQZZRGX-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H20O2 |
|---|---|
| Masa molowa | 172.26 g/mol |
| Nazwa IUPAC | 2-tert-butyl-3,3-dimethylbutanoic acid |
| InChIKey | CSUSKPNFQZZRGX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C(=O)O)C(C)(C)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Di-tert-Butylacetic acid, Butyric acid, 2-tert-butyl-3,3-dimethyl-, 2-tert-butyl-3,3-dimethylbutanoic acid, 2-(tert-butyl)-3,3-dimethylbutanoic acid, di-t-butylacetic acid, starbld0003481, CSUSKPNFQZZRGX-UHFFFAOYSA-N, 2-tert-Butyl-33-dimethylbutanoic acid, 2-tert-butyl-3,3-dimethyl-butanoic acid