cas: 855953-37-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
21-Bromohenicosanoic acid (CAS 855953-37-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25 g, 100 mg, 500 mg, 10 g, 250 mg, 5 g, 1 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-W355346-25 g |
| cas | 855953-37-6 |
| opakowanie | 25 g |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 25 g | 8228,42 Pln | |
| MedChemExpress | 100 mg | 263,96 Pln | |
| MedChemExpress | 500 mg | 551,89 Pln | |
| MedChemExpress | 10 g | 4174,21 Pln | |
| MedChemExpress | 250 mg | 407,93 Pln | |
| MedChemExpress | 5 g | 2446,64 Pln | |
| MedChemExpress | 1 g | 811,96 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | no data |
21-bromohenicosanoic acid (CAS 855953-37-6) to związek chemiczny o wzorze sumarycznym C21H41BrO2 i masie molowej 405.5 g/mol. Nazwa systematyczna IUPAC: 21-bromohenicosanoic acid. InChIKey: CORVQSQOTLKNEI-UHFFFAOYSA-N.
| Wzór sumaryczny | C21H41BrO2 |
|---|---|
| Masa molowa | 405.5 g/mol |
| Nazwa IUPAC | 21-bromohenicosanoic acid |
| InChIKey | CORVQSQOTLKNEI-UHFFFAOYSA-N |
| SMILES | C(CCCCCCCCCCBr)CCCCCCCCCC(=O)O |
Dane obliczone przez PubChem (NCBI)