3'-Chloro-[1,1'-biphenyl]-3-amine, 97%, 97%
cas: 56763-55-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
3'-Chloro-[1,1'-biphenyl]-3-amine, 97%, 97% (CAS 56763-55-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11EBP5-50mg |
| cas | 56763-55-4 |
| opakowanie | 50mg |
| dostępność | 19.9g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 50mg | 141,20 Pln | |
| Chemat | 100mg | 150,80 Pln | |
| Chemat | 250mg | 194,00 Pln | |
| Chemat | 500mg | 261,20 Pln | |
| Chemat | 1g | 314,00 Pln | |
| Chemat | 5g | 1086,80 Pln | |
| Chemat | 10g | 2061,20 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
3-(3-chlorophenyl)aniline (CAS 56763-55-4) to związek chemiczny o wzorze sumarycznym C12H10ClN i masie molowej 203.67 g/mol. Nazwa systematyczna IUPAC: 3-(3-chlorophenyl)aniline. InChIKey: GXRVJJBIJVHXOO-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H10ClN |
|---|---|
| Masa molowa | 203.67 g/mol |
| Nazwa IUPAC | 3-(3-chlorophenyl)aniline |
| InChIKey | GXRVJJBIJVHXOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC(=CC=C2)Cl |
Dane obliczone przez PubChem (NCBI)
Synonimy:
3-(3-chlorophenyl)aniline, 3'-Chloro-[1,1'-biphenyl]-3-amine, 3'-Chloro-biphenyl-3-amine, 3'-chlorobiphenyl-3-amine, 3'-chloro[1,1'-biphenyl]-3-amine, 3'-Chloro-3-Biphenylamine, [1,1'-Biphenyl]-3-amine, 3'-chloro-, 3-Amino-3'-chlorobiphenyl, GXRVJJBIJVHXOO-UHFFFAOYSA-N, (3'-chlorobiphenyl-3-yl)amine(SALTDATA: HCl)