3,3',5,5'-Tetramethylbiphenyl-4,4'-diol, 98%
cas: 2417-04-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
3,3',5,5'-Tetramethylbiphenyl-4,4'-diol, 98% (CAS 2417-04-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Oferty producentów: BLDpharm.
| producent | BLDpharm |
|---|---|
| nr katalogowy | BD90617-1g |
| cas | 2417-04-1 |
| opakowanie | 1g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| BLDpharm | 1g | 125,54 Pln | |
| BLDpharm | 5g | 136,64 Pln | |
| BLDpharm | 10g | 153,30 Pln | |
| BLDpharm | 25g | 186,63 Pln | |
| BLDpharm | 100g | 353,23 Pln | |
| BLDpharm | 500g | 1180,72 Pln | |
| BLDpharm | 1kg | 2291,44 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 1-2 tygodnie |
4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenol (CAS 2417-04-1) to związek chemiczny o wzorze sumarycznym C16H18O2 i masie molowej 242.31 g/mol. Nazwa systematyczna IUPAC: 4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenol. InChIKey: YGYPMFPGZQPETF-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H18O2 |
|---|---|
| Masa molowa | 242.31 g/mol |
| Nazwa IUPAC | 4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenol |
| InChIKey | YGYPMFPGZQPETF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)C)C2=CC(=C(C(=C2)C)O)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
3,3',5,5'-tetramethylbiphenyl-4,4'-diol, 2,2',6,6'-tetramethyl-4,4'-biphenol, 4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenol, [1,1'-Biphenyl]-4,4'-diol, 3,3',5,5'-tetramethyl-, 3,3',5,5'-tetramethyl-1,1'-biphenyl-4,4'-diol, 3,3',5,5'-tetramethyl-[1,1'-biphenyl]-4,4'-diol, di(2,6-dimethylphenol), 3,3',5,5'-tetramethyl[1,1'-biphenyl]-4,4'-diol, (1,1'-Biphenyl)-4,4'-diol, 3,3',5,5'-tetramethyl-, 2,2',6,6'-Tetramethyl-p,p'-biphenol