3,4-Dimethoxyphenylacetic acid, 99.60%
cas: 93-40-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
3,4-Dimethoxyphenylacetic acid, 99.60% (CAS 93-40-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10 g, 50 g, 100 g, 25 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-Y0771-10 g |
| cas | 93-40-3 |
| opakowanie | 10 g |
| dostępność | In stock |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10 g | 240,74 Pln | |
| MedChemExpress | 50 g | 384,71 Pln | |
| MedChemExpress | 100 g | 477,59 Pln | |
| MedChemExpress | 25 g | 310,40 Pln |
właściwości
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.60% |
2-(3,4-dimethoxyphenyl)acetic acid (CAS 93-40-3) to związek chemiczny o wzorze sumarycznym C10H12O4 i masie molowej 196.20 g/mol. Nazwa systematyczna IUPAC: 2-(3,4-dimethoxyphenyl)acetic acid. InChIKey: WUAXWQRULBZETB-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H12O4 |
|---|---|
| Masa molowa | 196.20 g/mol |
| Nazwa IUPAC | 2-(3,4-dimethoxyphenyl)acetic acid |
| InChIKey | WUAXWQRULBZETB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CC(=O)O)OC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Homoveratric acid, 3,4-Dimethoxyphenylacetic acid, 2-(3,4-dimethoxyphenyl)acetic acid, Benzeneacetic acid, 3,4-dimethoxy-, 3,4-Dimethoxybenzeneacetic acid, (3,4-Dimethoxyphenyl) Acetic Acid, 3,4-Dimethoxyphenyl acetic acid, (3,4-Dimethoxy-phenyl)-acetic acid, Acetic acid, (3,4-dimethoxyphenyl)-, 3,4-(Dimethoxy)benzeneacetic acid