3,5-Difluorophenylboronic acid neopentyl glycol ester, 98%, 98%
cas: 216393-57-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
3,5-Difluorophenylboronic acid neopentyl glycol ester, 98%, 98% (CAS 216393-57-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1181ER-250mg |
| cas | 216393-57-6 |
| opakowanie | 250mg |
| dostępność | 75g |
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 78,80 Pln | |
| Chemat | 1g | 88,40 Pln | |
| Chemat | 5g | 160,40 Pln | |
| Chemat | 25g | 558,80 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
2-(3,5-difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane (CAS 216393-57-6) to związek chemiczny o wzorze sumarycznym C11H13BF2O2 i masie molowej 226.03 g/mol. Nazwa systematyczna IUPAC: 2-(3,5-difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: OLHRAEPCGZMMTI-UHFFFAOYSA-N.
| Wzór sumaryczny | C11H13BF2O2 |
|---|---|
| Masa molowa | 226.03 g/mol |
| Nazwa IUPAC | 2-(3,5-difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | OLHRAEPCGZMMTI-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC(=CC(=C2)F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2-(3,5-difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 3,5-Difluorobenzeneboronic acid neopentyl glycol ester, 3,5-Difluorophenylboronic acid neopentyl glycol ester, 2-(3,5-difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborane, 1,3,2-Dioxaborinane, 2-(3,5-difluorophenyl)-5,5-dimethyl-, 3,5-difluorobenzeneboronic acid neopentyl glycol, 3,5-Difluorophenylboronic acidneopentylglycol ester, 3,5-Difluorobenzenebornoic acid neopentyl glycol cyclic ester