3,5-DiphenylphenylboronicAcid, 98%, 98%
cas: 128388-54-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
3,5-DiphenylphenylboronicAcid, 98%, 98% (CAS 128388-54-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch111Y29-250mg |
| cas | 128388-54-5 |
| opakowanie | 250mg |
| dostępność | 500g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 74,00 Pln | |
| Chemat | 1g | 78,80 Pln | |
| Chemat | 5g | 112,40 Pln | |
| Chemat | 10g | 165,20 Pln | |
| Chemat | 25g | 323,60 Pln | |
| Chemat | 100g | 1106,00 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
(3,5-diphenylphenyl)boronic acid (CAS 128388-54-5) to związek chemiczny o wzorze sumarycznym C18H15BO2 i masie molowej 274.1 g/mol. Nazwa systematyczna IUPAC: (3,5-diphenylphenyl)boronic acid. InChIKey: MRBZYVMZUBUDAX-UHFFFAOYSA-N.
| Wzór sumaryczny | C18H15BO2 |
|---|---|
| Masa molowa | 274.1 g/mol |
| Nazwa IUPAC | (3,5-diphenylphenyl)boronic acid |
| InChIKey | MRBZYVMZUBUDAX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C2=CC=CC=C2)C3=CC=CC=C3)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
3,5-diphenylphenylboronic acid, 3,5-DiphenylphenylboronicAcid, 5'-m-Terphenylboronic Acid, 3,5-Diphenylbenzeneboronic acid, (3,5-Diphenylphenyl)boronicacid, 5'-m-terphenylboronic acid (contains varying amounts of anhydride), 3',1''] terphenyl-5'-boronic acid, [1,1';3',1''] terphenyl-5'-boronic acid