cas: 54527-84-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-, 3-methyl 5-[2-[methyl(phenylmethyl)amino]ethyl] ester, hydrochloride (1:1), 99%, 99% (CAS 54527-84-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 25g, 1mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11DDUB-250mg |
| cas | 54527-84-3 |
| opakowanie | 250mg |
| dostępność | 50g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 131,60 Pln | |
| Chemat | 1g | 179,60 Pln | |
| Chemat | 5g | 381,20 Pln | |
| Chemat | 25g | 1005,20 Pln | |
| Chemat | 1mg | 78,80 Pln |
| czystość | 99% |
|---|---|
| czas dostawy | 3 tygodnie |
5-O-[2-[benzyl(methyl)amino]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride (CAS 54527-84-3) to związek chemiczny o wzorze sumarycznym C26H30ClN3O6 i masie molowej 516.0 g/mol. Nazwa systematyczna IUPAC: 5-O-[2-[benzyl(methyl)amino]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride. InChIKey: AIKVCUNQWYTVTO-UHFFFAOYSA-N.
| Wzór sumaryczny | C26H30ClN3O6 |
|---|---|
| Masa molowa | 516.0 g/mol |
| Nazwa IUPAC | 5-O-[2-[benzyl(methyl)amino]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
| InChIKey | AIKVCUNQWYTVTO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OCCN(C)CC2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OC.Cl |
Dane obliczone przez PubChem (NCBI)