3,7-Diaminophenothiazin-5-ium acetate, Dye content 85 %
cas: 78338-22-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
3,7-Diaminophenothiazin-5-ium acetate, Dye content 85 % (CAS 78338-22-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 25g. Oferty producentów: BLDpharm.
| producent | BLDpharm |
|---|---|
| nr katalogowy | BD121237-250mg |
| cas | 78338-22-4 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| BLDpharm | 250mg | 131,09 Pln | |
| BLDpharm | 1g | 214,39 Pln | |
| BLDpharm | 5g | 614,25 Pln | |
| BLDpharm | 25g | 2235,90 Pln |
właściwości
| czystość | Dye content 85 % |
|---|---|
| czas dostawy | 1-2 tygodnie |
(7-aminophenothiazin-3-ylidene)azanium acetate (CAS 78338-22-4) to związek chemiczny o wzorze sumarycznym C14H13N3O2S i masie molowej 287.34 g/mol. Nazwa systematyczna IUPAC: (7-aminophenothiazin-3-ylidene)azanium acetate. InChIKey: JOIRQYHDJINFGA-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H13N3O2S |
|---|---|
| Masa molowa | 287.34 g/mol |
| Nazwa IUPAC | (7-aminophenothiazin-3-ylidene)azanium acetate |
| InChIKey | JOIRQYHDJINFGA-UHFFFAOYSA-N |
| SMILES | CC(=O)[O-].C1=CC2=C(C=C1N)SC3=CC(=[NH2+])C=CC3=N2 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Thionin acetate, thionine acetate, Thionin acetate salt, Thioninacetat, 3,7-diaminophenothiazin-5-ium acetate, Phenothiazin-5-ium, 3,7-diamino-, acetate, 3,7Diamino5phenothiazinium acetate, 3,7-Diamino-5-phenothiazinium acetate, Thionin acetate (Thionine acetate), Thionin acetate salt Certified