3-(2,3,6-Trifluorophenyl)acrylic acid, 95% (E)
cas: 230295-12-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
3-(2,3,6-Trifluorophenyl)acrylic acid, 95% (E) (CAS 230295-12-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 100mg. Oferty producentów: Ambeed, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A330152-250mg |
| cas | 230295-12-2 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 147,88 Pln | |
| Ambeed | 1g | 281,38 Pln | |
| Ambeed | 5g | 704,12 Pln | |
| BLDpharm | 100mg | 125,54 Pln | |
| BLDpharm | 250mg | 136,64 Pln | |
| BLDpharm | 1g | 297,70 Pln | |
| BLDpharm | 5g | 753,09 Pln |
właściwości
| czystość | 95% (E) |
|---|---|
| czas dostawy | 1-2 tygodnie |
(E)-3-(2,3,6-trifluorophenyl)prop-2-enoic acid (CAS 230295-12-2) to związek chemiczny o wzorze sumarycznym C9H5F3O2 i masie molowej 202.13 g/mol. Nazwa systematyczna IUPAC: (E)-3-(2,3,6-trifluorophenyl)prop-2-enoic acid. InChIKey: OLYDUMMUGMYVHJ-DAFODLJHSA-N.
| Wzór sumaryczny | C9H5F3O2 |
|---|---|
| Masa molowa | 202.13 g/mol |
| Nazwa IUPAC | (E)-3-(2,3,6-trifluorophenyl)prop-2-enoic acid |
| InChIKey | OLYDUMMUGMYVHJ-DAFODLJHSA-N |
| SMILES | C1=CC(=C(C(=C1F)/C=C/C(=O)O)F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2,3,6-Trifluorocinnamic acid, 3-(2,3,6-Trifluorophenyl)acrylic acid, (E)-3-(2,3,6-trifluorophenyl)prop-2-enoic acid, (2E)-3-(2,3,6-trifluorophenyl)prop-2-enoic acid, 3-(2,3,6-trifluorophenyl)prop-2-enoic Acid, 2-Propenoic acid, 3-(2,3,6-trifluorophenyl)-, 3-(2,3,6-Trifluorophenyl)acrylicacid, (E)-3-(2,3,6-trifluorophenyl)acrylic acid, 2,3,6-Trifluorocinnamic Acid, Predominantly trans