3-(2-Chloro-5-nitrophenyl)acrylic acid, 98% (E)
cas: 36015-19-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
3-(2-Chloro-5-nitrophenyl)acrylic acid, 98% (E) (CAS 36015-19-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 25g. Oferty producentów: Ambeed, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A230647-1g |
| cas | 36015-19-7 |
| opakowanie | 1g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 1g | 125,62 Pln | |
| Ambeed | 5g | 203,50 Pln | |
| Ambeed | 25g | 464,94 Pln | |
| BLDpharm | 1g | 125,54 Pln | |
| BLDpharm | 5g | 214,39 Pln | |
| BLDpharm | 25g | 497,63 Pln |
właściwości
| czystość | 98% (E) |
|---|---|
| czas dostawy | 1-2 tygodnie |
(E)-3-(2-chloro-5-nitrophenyl)prop-2-enoic acid (CAS 36015-19-7) to związek chemiczny o wzorze sumarycznym C9H6ClNO4 i masie molowej 227.60 g/mol. Nazwa systematyczna IUPAC: (E)-3-(2-chloro-5-nitrophenyl)prop-2-enoic acid. InChIKey: IHTLKLSRRSWIGD-DAFODLJHSA-N.
| Wzór sumaryczny | C9H6ClNO4 |
|---|---|
| Masa molowa | 227.60 g/mol |
| Nazwa IUPAC | (E)-3-(2-chloro-5-nitrophenyl)prop-2-enoic acid |
| InChIKey | IHTLKLSRRSWIGD-DAFODLJHSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])/C=C/C(=O)O)Cl |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2-Chloro-5-nitrocinnamic acid, 3-(2-Chloro-5-nitrophenyl)acrylic acid, 3-(2-chloro-5-nitrophenyl)prop-2-enoic acid, 2-Chloro-5-nitrocinnamic acid, predominantly trans, (2E)-3-(2-chloro-5-nitrophenyl)prop-2-enoic acid, (E)-3-(2-chloro-5-nitrophenyl)prop-2-enoic acid, (E)-3-(2-chloro-5-nitrophenyl)acrylic acid, (2E)-3-(2-Chloro-5-nitrophenyl)-2-propenoic acid #, 3-(2-chloro-5-nitrophe, (2E)-3-(2-Chloro-5-nitrophenyl)-2-propenoic acid
