3-(3,4-Difluorophenyl)propanoic acid, 96%, 96%
cas: 161712-75-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
3-(3,4-Difluorophenyl)propanoic acid, 96%, 96% (CAS 161712-75-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch112VU2-250mg |
| cas | 161712-75-0 |
| opakowanie | 250mg |
| dostępność | 58g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 88,40 Pln | |
| Chemat | 1g | 93,20 Pln | |
| Chemat | 5g | 179,60 Pln | |
| Chemat | 10g | 251,60 Pln | |
| Chemat | 25g | 434,00 Pln |
właściwości
| czystość | 96% |
|---|---|
| czas dostawy | 3 tygodnie |
3-(3,4-difluorophenyl)propanoic acid (CAS 161712-75-0) to związek chemiczny o wzorze sumarycznym C9H8F2O2 i masie molowej 186.15 g/mol. Nazwa systematyczna IUPAC: 3-(3,4-difluorophenyl)propanoic acid. InChIKey: UOZIYCHJMUNLIG-UHFFFAOYSA-N.
| Wzór sumaryczny | C9H8F2O2 |
|---|---|
| Masa molowa | 186.15 g/mol |
| Nazwa IUPAC | 3-(3,4-difluorophenyl)propanoic acid |
| InChIKey | UOZIYCHJMUNLIG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCC(=O)O)F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
3,4-Difluorohydrocinnamic acid, 3-(3,4-difluorophenyl)propanoic Acid, Benzenepropanoic acid, 3,4-difluoro-, 3-(3,4-Difluorophenyl)propionic acid, 3-(3,4-difluorophenyl)-propionic acid, Benzenepropanoicacid,3,4-difluoro, 3-(3,4-difluorophenyl)propanoicAcid, 3,4-Difluorohydrocinnamic acid, 97%