3-(4-Chloro-3-nitrophenyl)acrylic acid, 98%
cas: 20797-48-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
3-(4-Chloro-3-nitrophenyl)acrylic acid, 98% (CAS 20797-48-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 10g, 25g. Oferty producentów: Chemat, Fluorochem.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch113JDN-1g |
| cas | 20797-48-2 |
| opakowanie | 1g |
| dostępność | 50g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1g | 98,00 Pln | |
| Chemat | 5g | 261,20 Pln | |
| Chemat | 10g | 448,40 Pln | |
| Chemat | 25g | 592,40 Pln | |
| Fluorochem | 1g | 112,48 Pln | |
| Fluorochem | 5g | 279,09 Pln | |
| Fluorochem | 25g | 586,27 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoic acid (CAS 20797-48-2) to związek chemiczny o wzorze sumarycznym C9H6ClNO4 i masie molowej 227.60 g/mol. Nazwa systematyczna IUPAC: (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoic acid. InChIKey: QBDALTIMHOITIU-DUXPYHPUSA-N.
| Wzór sumaryczny | C9H6ClNO4 |
|---|---|
| Masa molowa | 227.60 g/mol |
| Nazwa IUPAC | (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoic acid |
| InChIKey | QBDALTIMHOITIU-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)O)[N+](=O)[O-])Cl |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4-Chloro-3-nitrocinnamic acid, (e)-3-(4-chloro-3-nitrophenyl)acrylic acid, 3-(4-chloro-3-nitrophenyl)prop-2-enoic acid, 3-(4-Chloro-3-nitrophenyl)acrylic acid, (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoic acid, (2E)-3-(4-chloro-3-nitrophenyl)prop-2-enoic acid, trans-4-Chloro-3-nitrocinnamic acid, 2-Propenoic acid, 3-(4-chloro-3-nitrophenyl)-, (e)-3-(4-chloro-3-nitrophenyl)acrylicacid, QBDALTIMHOITIU-DUXPYHPUSA-