3-(4-Fluorobenzoyl)-1,1,1-trifluoroacetone, 95%
cas: 582-65-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
3-(4-Fluorobenzoyl)-1,1,1-trifluoroacetone, 95% (CAS 582-65-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A901236-250mg |
| cas | 582-65-0 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 170,12 Pln | |
| Ambeed | 1g | 214,62 Pln | |
| Ambeed | 5g | 776,44 Pln | |
| Chemat | 250mg | 88,40 Pln | |
| Chemat | 1g | 141,20 Pln | |
| Chemat | 5g | 342,80 Pln | |
| Chemat | 10g | 568,40 Pln | |
| BLDpharm | 250mg | 186,63 Pln | |
| BLDpharm | 1g | 225,50 Pln | |
| BLDpharm | 5g | 819,74 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 1-2 tygodnie |
4,4,4-trifluoro-1-(4-fluorophenyl)butane-1,3-dione (CAS 582-65-0) to związek chemiczny o wzorze sumarycznym C10H6F4O2 i masie molowej 234.15 g/mol. Nazwa systematyczna IUPAC: 4,4,4-trifluoro-1-(4-fluorophenyl)butane-1,3-dione. InChIKey: KEZLARPKXOHKJS-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H6F4O2 |
|---|---|
| Masa molowa | 234.15 g/mol |
| Nazwa IUPAC | 4,4,4-trifluoro-1-(4-fluorophenyl)butane-1,3-dione |
| InChIKey | KEZLARPKXOHKJS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(=O)C(F)(F)F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4,4,4-trifluoro-1-(4-fluorophenyl)butane-1,3-dione, 3-(4-fluorobenzoyl)-1,1,1-trifluoroacetone, 4,4,4-trifluoro-1-(4-fluorophenyl)-1,3-butanedione, 4,4,4-Trifluoro-1-(4-fluoro-phenyl)-butane-1,3-dione, 1,3-Butanedione, 4,4,4-trifluoro-1-(4-fluorophenyl)-, 4,4,4-Trifluoro-1-(4-fluorophenyl)butan-1,3-dione, 1-(4-fluoro-phenyl)-4,4,4-trifluoro-butane-1,3-dione, 4,4,4-trifluoro-1-[4-(fluoro)phenyl]-butane-1,3-dione