cas: 76093-35-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
3-{2-[benzyl(methyl)amino]ethyl} 5-methyl (4R)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate, 99.64%, 99.64% (CAS 76093-35-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch12P5L5-1mg |
| cas | 76093-35-1 |
| opakowanie | 1mg |
| dostępność | 0.05g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1mg | 947,60 Pln | |
| Chemat | 5mg | 1984,40 Pln | |
| Chemat | 10mg | 3040,40 Pln | |
| Chemat | 25mg | 5570,00 Pln | |
| Chemat | 50mg | 8526,80 Pln |
| czystość | 99.64% |
|---|---|
| czas dostawy | 3 tygodnie |
5-O-[2-[benzyl(methyl)amino]ethyl] 3-O-methyl (4R)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 76093-35-1) to związek chemiczny o wzorze sumarycznym C26H29N3O6 i masie molowej 479.5 g/mol. Nazwa systematyczna IUPAC: 5-O-[2-[benzyl(methyl)amino]ethyl] 3-O-methyl (4R)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: ZBBHBTPTTSWHBA-XMMPIXPASA-N.
| Wzór sumaryczny | C26H29N3O6 |
|---|---|
| Masa molowa | 479.5 g/mol |
| Nazwa IUPAC | 5-O-[2-[benzyl(methyl)amino]ethyl] 3-O-methyl (4R)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | ZBBHBTPTTSWHBA-XMMPIXPASA-N |
| SMILES | CC1=C([C@H](C(=C(N1)C)C(=O)OCCN(C)CC2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OC |
Dane obliczone przez PubChem (NCBI)