cas: 394-41-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
3-Fluoro-4-nitrophenol, 98%, 98% (CAS 394-41-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11BXD3-1g |
| cas | 394-41-2 |
| opakowanie | 1g |
| dostępność | 5000g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1g | 78,80 Pln | |
| Chemat | 5g | 112,40 Pln | |
| Chemat | 10g | 150,80 Pln | |
| Chemat | 25g | 246,80 Pln | |
| Chemat | 50g | 386,00 Pln | |
| Chemat | 100g | 611,60 Pln | |
| Chemat | 250g | 1370,00 Pln | |
| Chemat | 500g | 2611,20 Pln | |
| Chemat | 1kg | 3126,80 Pln | |
| Chemat | 5kg | 14496,00 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
3-fluoro-4-nitrophenol (CAS 394-41-2) to związek chemiczny o wzorze sumarycznym C6H4FNO3 i masie molowej 157.10 g/mol. Nazwa systematyczna IUPAC: 3-fluoro-4-nitrophenol. InChIKey: CSSGKHVRDGATJL-UHFFFAOYSA-N.
| Wzór sumaryczny | C6H4FNO3 |
|---|---|
| Masa molowa | 157.10 g/mol |
| Nazwa IUPAC | 3-fluoro-4-nitrophenol |
| InChIKey | CSSGKHVRDGATJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)F)[N+](=O)[O-] |
Dane obliczone przez PubChem (NCBI)