cas: 18685-18-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
3-O-Benzyl-1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose (CAS 18685-18-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10g, 25g, 50g, 5g, 100 mg, 5 g, 250 mg, 1 g. Oferty producentów: Chemat, MedChemExpress.
| producent | Chemat |
|---|---|
| nr katalogowy | CM25930C-10g |
| cas | 18685-18-2 |
| opakowanie | 10g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 10g | 2176,48 Pln | |
| Chemat | 25g | 4598,01 Pln | |
| Chemat | 50g | 8306,85 Pln | |
| Chemat | 5g | 1385,30 Pln | |
| MedChemExpress | 100 mg | 412,57 Pln | |
| MedChemExpress | 5 g | 1424,96 Pln | |
| MedChemExpress | 250 mg | 681,92 Pln | |
| MedChemExpress | 1 g | 997,72 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | no data |
| kategoria | Chemicals |
5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (CAS 18685-18-2) to związek chemiczny o wzorze sumarycznym C19H26O6 i masie molowej 350.4 g/mol. Nazwa systematyczna IUPAC: 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole. InChIKey: ZHFVGOMEUGAIJX-UHFFFAOYSA-N.
| Wzór sumaryczny | C19H26O6 |
|---|---|
| Masa molowa | 350.4 g/mol |
| Nazwa IUPAC | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| InChIKey | ZHFVGOMEUGAIJX-UHFFFAOYSA-N |
| SMILES | CC1(OCC(O1)C2C(C3C(O2)OC(O3)(C)C)OCC4=CC=CC=C4)C |
Dane obliczone przez PubChem (NCBI)