4,4'-(Phenylmethylene)bis(N,N-dimethylaniline)
cas: 129-73-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4,4'-(Phenylmethylene)bis(N,N-dimethylaniline) (CAS 129-73-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 10g, 25g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1191FC-1g |
| cas | 129-73-7 |
| opakowanie | 1g |
| dostępność | 500g |
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1g | 93,20 Pln | |
| Chemat | 5g | 179,60 Pln | |
| Chemat | 10g | 294,80 Pln | |
| Chemat | 25g | 534,80 Pln | |
| Chemat | 100g | 1941,20 Pln |
właściwości
| czas dostawy | 3 tygodnie |
|---|
4-[[4-(dimethylamino)phenyl]-phenylmethyl]-N,N-dimethylaniline (CAS 129-73-7) to związek chemiczny o wzorze sumarycznym C23H26N2 i masie molowej 330.5 g/mol. Nazwa systematyczna IUPAC: 4-[[4-(dimethylamino)phenyl]-phenylmethyl]-N,N-dimethylaniline. InChIKey: WZKXBGJNNCGHIC-UHFFFAOYSA-N.
| Wzór sumaryczny | C23H26N2 |
|---|---|
| Masa molowa | 330.5 g/mol |
| Nazwa IUPAC | 4-[[4-(dimethylamino)phenyl]-phenylmethyl]-N,N-dimethylaniline |
| InChIKey | WZKXBGJNNCGHIC-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(C2=CC=CC=C2)C3=CC=C(C=C3)N(C)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Leucomalachite green, Malachite green leuco, Malachite green leuco base, 4,4'-Bis(dimethylamino)triphenylmethane, C.I. Basic Green 4, leuco base, Tetramethyldiaminotriphenylmethane, Bis(p-dimethylaminophenyl)phenylmethane, p,p'-Benzylidenebis(N,N-dimethylaniline), 4,4'-Benzylidene bis(N,N-dimethylaniline), Aniline, 4,4'-benzylidenebis(N,N-dimethyl-