4,4'-Bis(trifluoromethyl)-1,1'-biphenyl, 98%
cas: 581-80-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4,4'-Bis(trifluoromethyl)-1,1'-biphenyl, 98% (CAS 581-80-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 100mg. Oferty producentów: Ambeed, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A1371196-250mg |
| cas | 581-80-6 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 481,62 Pln | |
| Ambeed | 1g | 793,12 Pln | |
| Ambeed | 5g | 2161,50 Pln | |
| Ambeed | 10g | 3340,75 Pln | |
| BLDpharm | 100mg | 236,61 Pln | |
| BLDpharm | 250mg | 475,41 Pln | |
| BLDpharm | 1g | 747,54 Pln | |
| BLDpharm | 5g | 2074,85 Pln | |
| BLDpharm | 10g | 3274,43 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 1-2 tygodnie |
1-(trifluoromethyl)-4-[4-(trifluoromethyl)phenyl]benzene (CAS 581-80-6) to związek chemiczny o wzorze sumarycznym C14H8F6 i masie molowej 290.20 g/mol. Nazwa systematyczna IUPAC: 1-(trifluoromethyl)-4-[4-(trifluoromethyl)phenyl]benzene. InChIKey: ITBRQMPOQQZNFT-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H8F6 |
|---|---|
| Masa molowa | 290.20 g/mol |
| Nazwa IUPAC | 1-(trifluoromethyl)-4-[4-(trifluoromethyl)phenyl]benzene |
| InChIKey | ITBRQMPOQQZNFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C(F)(F)F)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4,4'-Bis(trifluoromethyl)biphenyl, 4,4'-Bis[trifluoromethyl]biphenyl, ITBRQMPOQQZNFT-UHFFFAOYSA-N, 4,4'-Bis(trifluoromethyl)-1,1'-biphenyl, 1-(trifluoromethyl)-4-[4-(trifluoromethyl)phenyl]benzene, 1,1'-Biphenyl, 4,4'-bis(trifluoromethyl)-, 4,4'-Bis(trifluoromethyl)-1,1'-biphenyl #, 4,4'-Bis-(trifluoromethyl)biphenyl, bis(trifluoromethyl)biphenyl