4,4'-Dimethoxy-1,1'-biphenyl, 97%
cas: 2132-80-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4,4'-Dimethoxy-1,1'-biphenyl, 97% (CAS 2132-80-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 25g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114KDT-1g |
| cas | 2132-80-1 |
| opakowanie | 1g |
| dostępność | 200g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1g | 78,80 Pln | |
| Chemat | 5g | 93,20 Pln | |
| Chemat | 25g | 184,40 Pln | |
| Chemat | 100g | 554,00 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
1-methoxy-4-(4-methoxyphenyl)benzene (CAS 2132-80-1) to związek chemiczny o wzorze sumarycznym C14H14O2 i masie molowej 214.26 g/mol. Nazwa systematyczna IUPAC: 1-methoxy-4-(4-methoxyphenyl)benzene. InChIKey: UIMPAOAAAYDUKQ-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H14O2 |
|---|---|
| Masa molowa | 214.26 g/mol |
| Nazwa IUPAC | 1-methoxy-4-(4-methoxyphenyl)benzene |
| InChIKey | UIMPAOAAAYDUKQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)OC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
1,1'-Biphenyl, 4,4'-dimethoxy-, 4,4'-Dimethoxy-1,1'-biphenyl, 1-methoxy-4-(4-methoxyphenyl)benzene, 4,4'-Dimethoxy-biphenyl, 4,4 inverted exclamation mark -Dimethoxy-1,1 inverted exclamation mark -biphenyl, 4,4'-Bianisole, p-(4-methoxyphenyl)anisole, 4-(4-met, 4,4 inverted exclamation marka-Dimethoxybiphenyl, 4-(4-methoxyphenyl)anisole