cas: 1115639-92-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4,4,5,5-Tetramethyl-2-(3-(triphenylen-2-yl)phenyl)-1,3,2-dioxaborolane, 98%, 98% (CAS 1115639-92-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch119ZAY-250mg |
| cas | 1115639-92-3 |
| opakowanie | 250mg |
| dostępność | 10g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 83,60 Pln | |
| Chemat | 1g | 98,00 Pln | |
| Chemat | 5g | 232,40 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
4,4,5,5-tetramethyl-2-(3-triphenylen-2-ylphenyl)-1,3,2-dioxaborolane (CAS 1115639-92-3) to związek chemiczny o wzorze sumarycznym C30H27BO2 i masie molowej 430.3 g/mol. Nazwa systematyczna IUPAC: 4,4,5,5-tetramethyl-2-(3-triphenylen-2-ylphenyl)-1,3,2-dioxaborolane. InChIKey: NZTBACVVLACPNL-UHFFFAOYSA-N.
| Wzór sumaryczny | C30H27BO2 |
|---|---|
| Masa molowa | 430.3 g/mol |
| Nazwa IUPAC | 4,4,5,5-tetramethyl-2-(3-triphenylen-2-ylphenyl)-1,3,2-dioxaborolane |
| InChIKey | NZTBACVVLACPNL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C3=CC4=C(C=C3)C5=CC=CC=C5C6=CC=CC=C64 |
Dane obliczone przez PubChem (NCBI)