cas: 459409-74-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4,4,5,5-Tetramethyl-2-(5-phenylthiophen-2-yl)-1,3,2-dioxaborolane, 97%, 97% (CAS 459409-74-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11DAGL-100mg |
| cas | 459409-74-6 |
| opakowanie | 100mg |
| dostępność | 5g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 78,80 Pln | |
| Chemat | 250mg | 93,20 Pln | |
| Chemat | 1g | 179,60 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
4,4,5,5-tetramethyl-2-(5-phenylthiophen-2-yl)-1,3,2-dioxaborolane (CAS 459409-74-6) to związek chemiczny o wzorze sumarycznym C16H19BO2S i masie molowej 286.2 g/mol. Nazwa systematyczna IUPAC: 4,4,5,5-tetramethyl-2-(5-phenylthiophen-2-yl)-1,3,2-dioxaborolane. InChIKey: BOTJOCNWKJVWRR-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H19BO2S |
|---|---|
| Masa molowa | 286.2 g/mol |
| Nazwa IUPAC | 4,4,5,5-tetramethyl-2-(5-phenylthiophen-2-yl)-1,3,2-dioxaborolane |
| InChIKey | BOTJOCNWKJVWRR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C3=CC=CC=C3 |
Dane obliczone przez PubChem (NCBI)