4,4,7,7-Tetraethoxy-3,8-dioxa-4,7-disiladecane, 95%, 95%
cas: 16068-37-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4,4,7,7-Tetraethoxy-3,8-dioxa-4,7-disiladecane, 95%, 95% (CAS 16068-37-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10g, 25g, 100g, 500g, 1kg, 5kg, 25kg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch112S5F-10g |
| cas | 16068-37-4 |
| opakowanie | 10g |
| dostępność | 100000g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 10g | 78,80 Pln | |
| Chemat | 25g | 83,60 Pln | |
| Chemat | 100g | 88,40 Pln | |
| Chemat | 500g | 206,40 Pln | |
| Chemat | 1kg | 323,60 Pln | |
| Chemat | 5kg | 1593,60 Pln | |
| Chemat | 25kg | cena na żądanie |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
Triethoxy(2-triethoxysilylethyl)silane (CAS 16068-37-4) to związek chemiczny o wzorze sumarycznym C14H34O6Si2 i masie molowej 354.59 g/mol. Nazwa systematyczna IUPAC: triethoxy(2-triethoxysilylethyl)silane. InChIKey: IZRJPHXTEXTLHY-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H34O6Si2 |
|---|---|
| Masa molowa | 354.59 g/mol |
| Nazwa IUPAC | triethoxy(2-triethoxysilylethyl)silane |
| InChIKey | IZRJPHXTEXTLHY-UHFFFAOYSA-N |
| SMILES | CCO[Si](CC[Si](OCC)(OCC)OCC)(OCC)OCC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
1,2-Bis(triethoxysilyl)ethane, 3,8-Dioxa-4,7-disiladecane, 4,4,7,7-tetraethoxy-, Bis(triethoxysilyl)ethane, 4,4,7,7-Tetraethoxy-3,8-dioxa-4,7-disiladecane, triethoxy(2-triethoxysilylethyl)silane, C14H34O6Si2, Ethylenebis(triethoxysilane), 1,2-Bis(triethoxysilyl)ethane,, 1,2-Bis(triethoxysilyl)ethane(Hexaethoxydisilethylene), HEXAETHOXYDISILETHYLENE, BSE