4,4′-Diacetylbibenzyl, 98%
cas: 793-06-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4,4′-Diacetylbibenzyl, 98% (CAS 793-06-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch119MJC-100mg |
| cas | 793-06-6 |
| opakowanie | 100mg |
| dostępność | 125g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 102,80 Pln | |
| Chemat | 250mg | 126,80 Pln | |
| Chemat | 1g | 213,20 Pln | |
| Chemat | 5g | 414,80 Pln | |
| Chemat | 10g | 746,00 Pln | |
| Chemat | 25g | 1130,00 Pln | |
| Chemat | 50g | 2147,60 Pln | |
| Chemat | 100g | 4125,20 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
1-[4-[2-(4-acetylphenyl)ethyl]phenyl]ethanone (CAS 793-06-6) to związek chemiczny o wzorze sumarycznym C18H18O2 i masie molowej 266.3 g/mol. Nazwa systematyczna IUPAC: 1-[4-[2-(4-acetylphenyl)ethyl]phenyl]ethanone. InChIKey: ZSLCVLSXAOHWBQ-UHFFFAOYSA-N.
| Wzór sumaryczny | C18H18O2 |
|---|---|
| Masa molowa | 266.3 g/mol |
| Nazwa IUPAC | 1-[4-[2-(4-acetylphenyl)ethyl]phenyl]ethanone |
| InChIKey | ZSLCVLSXAOHWBQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)CCC2=CC=C(C=C2)C(=O)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4,4'-Diacetylbibenzyl, Ethanone, 1,1'-(1,2-ethanediyldi-4,1-phenylene)bis-, 1,1'-(1,2-Ethanediyldi-4,1-phenylene)bisethanone, 4,4'-Diacetyldiphenylethane, 1-[4-[2-(4-acetylphenyl)ethyl]phenyl]ethanone, 1,1'-(Ethane-1,2-diylbis(4,1-phenylene))diethanone, Ethanone,1,1'-(1,2-ethanediyldi-4,1-phenylene)bis- (9CI), 1,2-bis(4-acetylphenyl)ethane, 1,1'-(Ethane-1,2-diylbis(4,1-phenylene))bis(ethan-1-one), 1-{4-[2-(4-acetylphenyl)ethyl]phenyl}ethanone
