4,4′-Diaminobenzophenone, 99.90%
cas: 611-98-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4,4′-Diaminobenzophenone, 99.90% (CAS 611-98-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100 g, 50 g, 10 g, 5 g, 25 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-W014290-100 g |
| cas | 611-98-3 |
| opakowanie | 100 g |
| dostępność | In stock |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 100 g | 1819,70 Pln | |
| MedChemExpress | 50 g | 1174,19 Pln | |
| MedChemExpress | 10 g | 445,08 Pln | |
| MedChemExpress | 5 g | 310,40 Pln | |
| MedChemExpress | 25 g | 784,09 Pln |
właściwości
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.90% |
Bis(4-aminophenyl)methanone (CAS 611-98-3) to związek chemiczny o wzorze sumarycznym C13H12N2O i masie molowej 212.25 g/mol. Nazwa systematyczna IUPAC: bis(4-aminophenyl)methanone. InChIKey: ZLSMCQSGRWNEGX-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H12N2O |
|---|---|
| Masa molowa | 212.25 g/mol |
| Nazwa IUPAC | bis(4-aminophenyl)methanone |
| InChIKey | ZLSMCQSGRWNEGX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)N)N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4,4'-Diaminobenzophenone, Bis(4-aminophenyl)methanone, Methanone, bis(4-aminophenyl)-, 4,4 inverted exclamation mark -Diaminobenzophenone, di4-aminophenyl ketone, 4,4'-diaminobenzophenon, 4,4''-Diaminobenzophenone, 4,4\'-Diaminobenzophenone, 4,4 inverted exclamation marka-Diaminobenzophenone, Bis(4-aminophenyl)methanone #