4,4-Methylenebis(2,6-dimethylaniline), 97%
cas: 4073-98-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4,4-Methylenebis(2,6-dimethylaniline), 97% (CAS 4073-98-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5g, 25g, 100g, 500g, 1g. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A252768-5g |
| cas | 4073-98-7 |
| opakowanie | 5g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 5g | 175,69 Pln | |
| Ambeed | 25g | 414,88 Pln | |
| Ambeed | 100g | 1260,38 Pln | |
| Ambeed | 500g | 4831,50 Pln | |
| Chemat | 1g | 93,20 Pln | |
| Chemat | 5g | 179,60 Pln | |
| Chemat | 25g | 467,60 Pln | |
| Chemat | 100g | 1557,20 Pln | |
| Chemat | 500g | 6105,60 Pln | |
| BLDpharm | 5g | 186,63 Pln | |
| BLDpharm | 25g | 442,09 Pln | |
| BLDpharm | 100g | 1352,88 Pln | |
| BLDpharm | 500g | 5207,08 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 2-3 tygodnie |
4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline (CAS 4073-98-7) to związek chemiczny o wzorze sumarycznym C17H22N2 i masie molowej 254.37 g/mol. Nazwa systematyczna IUPAC: 4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline. InChIKey: OMHOXRVODFQGCA-UHFFFAOYSA-N.
| Wzór sumaryczny | C17H22N2 |
|---|---|
| Masa molowa | 254.37 g/mol |
| Nazwa IUPAC | 4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline |
| InChIKey | OMHOXRVODFQGCA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C)CC2=CC(=C(C(=C2)C)N)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4,4'-Methylenebis(2,6-dimethylaniline), 4,4'-Methylenebis(2,6-xylidine), Benzenamine, 4,4'-methylenebis(2,6-dimethyl-, Benzenamine, 4,4'-methylenebis[2,6-dimethyl-, bis(4-amino-3,5-dimethylphenyl)methane, 3,3',5,5'-tetramethyl-4,4'-diaminodiphenylmethane, 4-(4-Amino-3,5-dimethylbenzyl)-2,6-dimethylaniline, 4,4-methylenebis(2,6-dimethylaniline), 4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline, MBDA-Form-I