4,5-Dimethoxy-2-(trimethylsilyl)phenyl trifluoromethanesulfonate, 98%
cas: 866252-52-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4,5-Dimethoxy-2-(trimethylsilyl)phenyl trifluoromethanesulfonate, 98% (CAS 866252-52-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A109310-100mg |
| cas | 866252-52-0 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 448,25 Pln | |
| Ambeed | 250mg | 765,31 Pln | |
| Ambeed | 1g | 1939,00 Pln | |
| Chemat | 100mg | 448,40 Pln | |
| Chemat | 250mg | 760,40 Pln | |
| Chemat | 1g | 1941,20 Pln | |
| Chemat | 5g | 5469,20 Pln | |
| BLDpharm | 100mg | 480,97 Pln | |
| BLDpharm | 250mg | 819,74 Pln | |
| BLDpharm | 1g | 2085,96 Pln | |
| BLDpharm | 5g | 5862,40 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 2-3 tygodnie |
(4,5-dimethoxy-2-trimethylsilylphenyl) trifluoromethanesulfonate (CAS 866252-52-0) to związek chemiczny o wzorze sumarycznym C12H17F3O5SSi i masie molowej 358.41 g/mol. Nazwa systematyczna IUPAC: (4,5-dimethoxy-2-trimethylsilylphenyl) trifluoromethanesulfonate. InChIKey: DLUVZOFWZNLGTJ-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H17F3O5SSi |
|---|---|
| Masa molowa | 358.41 g/mol |
| Nazwa IUPAC | (4,5-dimethoxy-2-trimethylsilylphenyl) trifluoromethanesulfonate |
| InChIKey | DLUVZOFWZNLGTJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1OC)[Si](C)(C)C)OS(=O)(=O)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4,5-Dimethoxy-2-(trimethylsilyl)phenyl Trifluoromethanesulfonate, 4,5-Dimethoxy-2-(trimethylsilyl)phenyl Triflate, (4,5-dimethoxy-2-trimethylsilylphenyl) trifluoromethanesulfonate, Trifluoromethanesulfonic Acid 4,5-Dimethoxy-2-(trimethylsilyl)phenyl Ester, C12H17F3O5SSi, DLUVZOFWZNLGTJ-UHFFFAOYSA-N, 4,5-Dimethoxy-2-(trimethylsilyl)phenylTrifluoromethanesulfonate, (4,5-dimethoxy-2-trimethylsilyl-phenyl) trifluoromethanesulfonate