4-(tert-Butyl)-1,1'-biphenyl, 98%, 98%
cas: 1625-92-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4-(tert-Butyl)-1,1'-biphenyl, 98%, 98% (CAS 1625-92-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch112T7Z-100mg |
| cas | 1625-92-9 |
| opakowanie | 100mg |
| dostępność | 125g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 98,00 Pln | |
| Chemat | 250mg | 112,40 Pln | |
| Chemat | 1g | 165,20 Pln | |
| Chemat | 5g | 376,40 Pln | |
| Chemat | 10g | 582,80 Pln | |
| Chemat | 25g | 1106,00 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
1-tert-butyl-4-phenylbenzene (CAS 1625-92-9) to związek chemiczny o wzorze sumarycznym C16H18 i masie molowej 210.31 g/mol. Nazwa systematyczna IUPAC: 1-tert-butyl-4-phenylbenzene. InChIKey: CDOYZTOFTGTGBC-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H18 |
|---|---|
| Masa molowa | 210.31 g/mol |
| Nazwa IUPAC | 1-tert-butyl-4-phenylbenzene |
| InChIKey | CDOYZTOFTGTGBC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CC=CC=C2 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4-tert-Butylbiphenyl, 4-(tert-Butyl)-1,1'-biphenyl, 1-tert-butyl-4-phenylbenzene, 1,1'-Biphenyl, 4-(1,1-dimethylethyl)-, 1-tert-butyl-4-phenyl-benzene, 4-t-butylbiphenyl, 4-tert-Butyldiphenyl, CDOYZTOFTGTGBC-UHFFFAOYSA-N, 4-tert-Butylbiphenyl Zone Refined, 4-(1,1-Dimethylethyl)-1,1'-biphenyl