cas: 2649467-58-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4-[[[(2R,3S,4S,5R)-3-(3,4-Difluoro-2-methoxyphenyl)tetrahydro-4,5-dimethyl-5-(trifluoromethyl)-2-furanyl]carbonyl]amino]-2-pyridinecarboxamide, 98%, 98% (CAS 2649467-58-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 50mg, 100mg, 250mg, 1g, 10mg, 25mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch13ACOT-1mg |
| cas | 2649467-58-1 |
| opakowanie | 1mg |
| dostępność | 250g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1mg | 93,20 Pln | |
| Chemat | 5mg | 102,80 Pln | |
| Chemat | 50mg | 237,20 Pln | |
| Chemat | 100mg | 285,20 Pln | |
| Chemat | 250mg | 549,20 Pln | |
| Chemat | 1g | 1547,60 Pln | |
| Chemat | 10mg | 131,60 Pln | |
| Chemat | 25mg | 179,60 Pln | |
| Chemat | 5g | 3885,20 Pln | |
| Chemat | 10g | 5411,60 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (CAS 2649467-58-1) to związek chemiczny o wzorze sumarycznym C21H20F5N3O4 i masie molowej 473.4 g/mol. Nazwa systematyczna IUPAC: 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide. InChIKey: XSQUJFKRXZMOKA-PAFIKIDNSA-N.
| Wzór sumaryczny | C21H20F5N3O4 |
|---|---|
| Masa molowa | 473.4 g/mol |
| Nazwa IUPAC | 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| InChIKey | XSQUJFKRXZMOKA-PAFIKIDNSA-N |
| SMILES | C[C@H]1[C@H]([C@@H](O[C@@]1(C)C(F)(F)F)C(=O)NC2=CC(=NC=C2)C(=O)N)C3=C(C(=C(C=C3)F)F)OC |
Dane obliczone przez PubChem (NCBI)