cas: 644-08-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4-Methylbiphenyl, 99.98% (CAS 644-08-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5 g, 10 g, 25 g, 100 g, 10mM/1mL, 50 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-W017077-5 g |
| cas | 644-08-6 |
| opakowanie | 5 g |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 5 g | 240,74 Pln | |
| MedChemExpress | 10 g | 263,96 Pln | |
| MedChemExpress | 25 g | 361,49 Pln | |
| MedChemExpress | 100 g | 598,33 Pln | |
| MedChemExpress | 10mM/1mL | 254,68 Pln | |
| MedChemExpress | 50 g | 454,37 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.98% |
1-methyl-4-phenylbenzene (CAS 644-08-6) to związek chemiczny o wzorze sumarycznym C13H12 i masie molowej 168.23 g/mol. Nazwa systematyczna IUPAC: 1-methyl-4-phenylbenzene. InChIKey: ZZLCFHIKESPLTH-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H12 |
|---|---|
| Masa molowa | 168.23 g/mol |
| Nazwa IUPAC | 1-methyl-4-phenylbenzene |
| InChIKey | ZZLCFHIKESPLTH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=CC=C2 |
Dane obliczone przez PubChem (NCBI)