4-Methyldibenzo[b,d]thiophene, 98%
cas: 7372-88-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4-Methyldibenzo[b,d]thiophene, 98% (CAS 7372-88-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Ambeed, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A191223-250mg |
| cas | 7372-88-5 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 209,06 Pln | |
| Ambeed | 1g | 387,06 Pln | |
| Ambeed | 5g | 1232,56 Pln | |
| Ambeed | 10g | 2228,25 Pln | |
| Ambeed | 25g | 4386,50 Pln | |
| BLDpharm | 250mg | 219,95 Pln | |
| BLDpharm | 1g | 414,32 Pln | |
| BLDpharm | 5g | 1325,11 Pln | |
| BLDpharm | 10g | 2396,96 Pln | |
| BLDpharm | 25g | 4723,92 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 1-2 tygodnie |
4-methyldibenzothiophene (CAS 7372-88-5) to związek chemiczny o wzorze sumarycznym C13H10S i masie molowej 198.29 g/mol. Nazwa systematyczna IUPAC: 4-methyldibenzothiophene. InChIKey: NICUQYHIOMMFGV-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H10S |
|---|---|
| Masa molowa | 198.29 g/mol |
| Nazwa IUPAC | 4-methyldibenzothiophene |
| InChIKey | NICUQYHIOMMFGV-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C3=CC=CC=C3S2 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
6-methyl-8-thiatricyclo[7.4.0.0^{2,7}]trideca-1(13),2,4,6,9,11-hexaene, 6-methyl-8-thiatricyclo(7.4.0.0^(2,7))trideca-1(13),2,4,6,9,11-hexaene, 4-Methyldibenzo[b,d]thiophene, Dibenzothiophene, 4-methyl-, Dibenzothiophene, 1-methyl-, dibenzo[b,d]thiophene, 4-methyl-, 4-methyl-dibenzothiophene, 4-Methyldibenzothiophene, 96%, 4-Methyldibenzo[b,d]thiophene #, 4-Methyldibenzothiophene Solution in Toluene, 1000ug/mL