4-Nitrophenyl (2-(trimethylsilyl)ethyl) carbonate, 97%, 97%
cas: 80149-80-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4-Nitrophenyl (2-(trimethylsilyl)ethyl) carbonate, 97%, 97% (CAS 80149-80-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114LVS-250mg |
| cas | 80149-80-0 |
| opakowanie | 250mg |
| dostępność | 1000g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 78,80 Pln | |
| Chemat | 1g | 112,40 Pln | |
| Chemat | 5g | 290,00 Pln | |
| Chemat | 10g | 496,40 Pln | |
| Chemat | 25g | 1110,80 Pln | |
| Chemat | 100g | 3904,40 Pln | |
| Chemat | 500g | 15508,80 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
(4-nitrophenyl) 2-trimethylsilylethyl carbonate (CAS 80149-80-0) to związek chemiczny o wzorze sumarycznym C12H17NO5Si i masie molowej 283.35 g/mol. Nazwa systematyczna IUPAC: (4-nitrophenyl) 2-trimethylsilylethyl carbonate. InChIKey: ZAQWGGKIMQIVGM-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H17NO5Si |
|---|---|
| Masa molowa | 283.35 g/mol |
| Nazwa IUPAC | (4-nitrophenyl) 2-trimethylsilylethyl carbonate |
| InChIKey | ZAQWGGKIMQIVGM-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4-Nitrophenyl 2-(trimethylsilyl)ethyl carbonate, 4-Nitrophenyl (2-(trimethylsilyl)ethyl) carbonate, TEOC-ONp, (4-nitrophenyl) 2-trimethylsilylethyl carbonate, C12H17NO5Si, 4-[2-(Trimethylsilyl)ethoxycarbonyloxy]nitrobenzene, Carbonic acid, 4-nitrophenyl 2-(trimethylsilyl)ethyl ester, 2-(Trimethylsilyl)ethyl 4-nitrophenyl carbonate, 2-trimethylsilanylethyl 4-nitrophenyl carbonate, 4-Nitrophenyl 2-(trimethylsilyl)ethyl carbonate, >=95.0% (NMR)