4-Nitrophenyl (thiazol-5-ylmethyl) carbonate, 97%
cas: 144163-97-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4-Nitrophenyl (thiazol-5-ylmethyl) carbonate, 97% (CAS 144163-97-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5g, 10g, 25g, 100g. Oferty producentów: Ambeed, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A366370-5g |
| cas | 144163-97-3 |
| opakowanie | 5g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 5g | 125,62 Pln | |
| Ambeed | 10g | 131,19 Pln | |
| Ambeed | 25g | 153,44 Pln | |
| Ambeed | 100g | 370,38 Pln | |
| BLDpharm | 5g | 125,54 Pln | |
| BLDpharm | 10g | 136,64 Pln | |
| BLDpharm | 25g | 158,86 Pln | |
| BLDpharm | 100g | 397,66 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 1-2 tygodnie |
(4-nitrophenyl) 1,3-thiazol-5-ylmethyl carbonate (CAS 144163-97-3) to związek chemiczny o wzorze sumarycznym C11H8N2O5S i masie molowej 280.26 g/mol. Nazwa systematyczna IUPAC: (4-nitrophenyl) 1,3-thiazol-5-ylmethyl carbonate. InChIKey: FTEKBGGQRNJIPQ-UHFFFAOYSA-N.
| Wzór sumaryczny | C11H8N2O5S |
|---|---|
| Masa molowa | 280.26 g/mol |
| Nazwa IUPAC | (4-nitrophenyl) 1,3-thiazol-5-ylmethyl carbonate |
| InChIKey | FTEKBGGQRNJIPQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC(=O)OCC2=CN=CS2 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4-nitrophenyl 1,3-thiazol-5-ylmethyl carbonate, 4-Nitrophenyl (thiazol-5-ylmethyl) carbonate, Thiazolylmethyl-4-nitrophenylcarbonate, Carbonic acid, 4-nitrophenyl 5-thiazolylmethyl ester, (4-nitrophenyl) thiazol-5-ylmethyl carbonate, (4-nitrophenyl) 1,3-thiazol-5-ylmethyl Carbonate, 4-Nitrophenyl (1,3-thiazol-5-yl)methyl carbonate, 4-nitrophenyl thiazol-5-ylmethyl carbonate, FTEKBGGQRNJIPQ-UHFFFAOYSA-N, 4-Nitrophenyl(thiazol-5-ylmethyl)carbonate