4-Phenylcyclohexanecarboxylic acid, 97%, 97%
cas: 7494-76-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4-Phenylcyclohexanecarboxylic acid, 97%, 97% (CAS 7494-76-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11G5HL-100mg |
| cas | 7494-76-0 |
| opakowanie | 100mg |
| dostępność | 25g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 208,40 Pln | |
| Chemat | 250mg | 357,20 Pln | |
| Chemat | 500mg | 582,80 Pln | |
| Chemat | 1g | 990,80 Pln | |
| Chemat | 5g | 3544,40 Pln | |
| Chemat | 10g | 5862,80 Pln | |
| Chemat | 25g | 11666,00 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
4-phenylcyclohexane-1-carboxylic acid (CAS 7494-76-0) to związek chemiczny o wzorze sumarycznym C13H16O2 i masie molowej 204.26 g/mol. Nazwa systematyczna IUPAC: 4-phenylcyclohexane-1-carboxylic acid. InChIKey: SYYSTPDYCASVSQ-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H16O2 |
|---|---|
| Masa molowa | 204.26 g/mol |
| Nazwa IUPAC | 4-phenylcyclohexane-1-carboxylic acid |
| InChIKey | SYYSTPDYCASVSQ-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C2=CC=CC=C2)C(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4-Phenyl-cyclohexanecarboxylic acid, 4-Phenylcyclohexanecarboxylic acid, 4-phenylcyclohexane-1-carboxylic acid, trans-4-Phenylcyclohexanecarboxylic acid, trans-4-henylcyclohexanecarboxylic acid, Atovaquone Impurity 23, Cyclohexanecarboxylic acid, 4-phenyl-, trans-, Cambridge id 5301879, (1r,4r)-4-Phenylcyclohexane-1-carboxylic acid, Oprea1_230010