cas: 80756-85-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4-Thiazoleethanethioic acid, 2-amino-α-(methoxyimino)-, S-2-benzothiazolyl ester, (αZ)-, 97%, 97% (CAS 80756-85-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5g, 25g, 100g, 50g, 75g, 200g, 300g, 400g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114CPR-5g |
| cas | 80756-85-0 |
| opakowanie | 5g |
| dostępność | 1000g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 5g | 78,80 Pln | |
| Chemat | 25g | 93,20 Pln | |
| Chemat | 100g | 170,00 Pln | |
| Chemat | 50g | 126,80 Pln | |
| Chemat | 75g | 155,60 Pln | |
| Chemat | 200g | 266,00 Pln | |
| Chemat | 300g | 366,80 Pln | |
| Chemat | 400g | 462,80 Pln | |
| Chemat | 500g | 590,40 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
S-(1,3-benzothiazol-2-yl) (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioate (CAS 80756-85-0) to związek chemiczny o wzorze sumarycznym C13H10N4O2S3 i masie molowej 350.4 g/mol. Nazwa systematyczna IUPAC: S-(1,3-benzothiazol-2-yl) (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioate. InChIKey: COFDRZLHVALCDU-YVLHZVERSA-N.
| Wzór sumaryczny | C13H10N4O2S3 |
|---|---|
| Masa molowa | 350.4 g/mol |
| Nazwa IUPAC | S-(1,3-benzothiazol-2-yl) (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioate |
| InChIKey | COFDRZLHVALCDU-YVLHZVERSA-N |
| SMILES | CO/N=C(/C1=CSC(=N1)N)\C(=O)SC2=NC3=CC=CC=C3S2 |
Dane obliczone przez PubChem (NCBI)